C17H26N3O2+ — CID 8772439
[2-(N-cyclohexylanilino)-2-oxoethyl]-[2-(methylamino)-2-oxoethyl]azanium (PubChem CID 8772439) has the molecular formula C17H26N3O2+ and a molecular weight of 304.41 g/mol. Its IUPAC name is [2-(N-cyclohexylanilino)-2-oxoethyl]-[2-(methylamino)-2-oxoethyl]azanium.
| Compound Name | [2-(N-cyclohexylanilino)-2-oxoethyl]-[2-(methylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8772439 |
| Molecular Formula | C17H26N3O2+ |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | [2-(N-cyclohexylanilino)-2-oxoethyl]-[2-(methylamino)-2-oxoethyl]azanium |
| SMILES | CNC(=O)C[NH2+]CC(=O)N(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C17H25N3O2/c1-18-16(21)12-19-13-17(22)20(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2,4-5,8-9,15,19H,3,6-7,10-13H2,1H3,(H,18,21)/p+1 |
| InChIKey | SCLNBRZZYRKJDO-UHFFFAOYSA-O |
| XLogP | 0.66 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |