C22H32N2O2 — CID 22251074
N-cyclohexyl-2-[[3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]amino]-N-phenylacetamide (PubChem CID 22251074) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is N-cyclohexyl-2-[[3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]amino]-N-phenylacetamide.
| Compound Name | N-cyclohexyl-2-[[3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]amino]-N-phenylacetamide |
|---|---|
| PubChem CID | 22251074 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | N-cyclohexyl-2-[[3-(hydroxymethyl)-2-bicyclo[2.2.1]heptanyl]amino]-N-phenylacetamide |
| SMILES | O=C(CNC1C2CCC(C2)C1CO)N(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C22H32N2O2/c25-15-20-16-11-12-17(13-16)22(20)23-14-21(26)24(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1,3-4,7-8,16-17,19-20,22-23,25H,2,5-6,9-15H2 |
| InChIKey | MCIDUJJGZTWLQC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |