C32H36ClNO2 — CID 174503725
N-(3-chlorophenyl)-N-cyclohexyl-3-[(4-cyclohexylphenoxy)methyl]benzamide (PubChem CID 174503725) has the molecular formula C32H36ClNO2 and a molecular weight of 502.10 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N-cyclohexyl-3-[(4-cyclohexylphenoxy)methyl]benzamide.
| Compound Name | N-(3-chlorophenyl)-N-cyclohexyl-3-[(4-cyclohexylphenoxy)methyl]benzamide |
|---|---|
| PubChem CID | 174503725 |
| Molecular Formula | C32H36ClNO2 |
| Molecular Weight | 502.10 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | N-(3-chlorophenyl)-N-cyclohexyl-3-[(4-cyclohexylphenoxy)methyl]benzamide |
| SMILES | O=C(c1cccc(COc2ccc(C3CCCCC3)cc2)c1)N(c1cccc(Cl)c1)C1CCCCC1 |
| InChI | InChI=1S/C32H36ClNO2/c33-28-13-8-16-30(22-28)34(29-14-5-2-6-15-29)32(35)27-12-7-9-24(21-27)23-36-31-19-17-26(18-20-31)25-10-3-1-4-11-25/h7-9,12-13,16-22,25,29H,1-6,10-11,14-15,23H2 |
| InChIKey | HHISLLZLPDTXCU-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.10 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |