C29H32ClNO2 — CID 174503718
N-(3-chlorophenyl)-3-[(4-cyclohexylphenoxy)methyl]-N-propan-2-ylbenzamide (PubChem CID 174503718) has the molecular formula C29H32ClNO2 and a molecular weight of 462.03 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-[(4-cyclohexylphenoxy)methyl]-N-propan-2-ylbenzamide.
| Compound Name | N-(3-chlorophenyl)-3-[(4-cyclohexylphenoxy)methyl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 174503718 |
| Molecular Formula | C29H32ClNO2 |
| Molecular Weight | 462.03 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | N-(3-chlorophenyl)-3-[(4-cyclohexylphenoxy)methyl]-N-propan-2-ylbenzamide |
| SMILES | CC(C)N(C(=O)c1cccc(COc2ccc(C3CCCCC3)cc2)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C29H32ClNO2/c1-21(2)31(27-13-7-12-26(30)19-27)29(32)25-11-6-8-22(18-25)20-33-28-16-14-24(15-17-28)23-9-4-3-5-10-23/h6-8,11-19,21,23H,3-5,9-10,20H2,1-2H3 |
| InChIKey | CDQNTZTUPNQRRS-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.03 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |