C34H34ClNO2 — CID 174503803
N-(3-chlorophenyl)-3-[[4-(2-cyclopentylphenyl)phenoxy]methyl]-N-propan-2-ylbenzamide (PubChem CID 174503803) has the molecular formula C34H34ClNO2 and a molecular weight of 524.10 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-[[4-(2-cyclopentylphenyl)phenoxy]methyl]-N-propan-2-ylbenzamide.
| Compound Name | N-(3-chlorophenyl)-3-[[4-(2-cyclopentylphenyl)phenoxy]methyl]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 174503803 |
| Molecular Formula | C34H34ClNO2 |
| Molecular Weight | 524.10 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | N-(3-chlorophenyl)-3-[[4-(2-cyclopentylphenyl)phenoxy]methyl]-N-propan-2-ylbenzamide |
| SMILES | CC(C)N(C(=O)c1cccc(COc2ccc(-c3ccccc3C3CCCC3)cc2)c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C34H34ClNO2/c1-24(2)36(30-14-8-13-29(35)22-30)34(37)28-12-7-9-25(21-28)23-38-31-19-17-27(18-20-31)33-16-6-5-15-32(33)26-10-3-4-11-26/h5-9,12-22,24,26H,3-4,10-11,23H2,1-2H3 |
| InChIKey | SQJURJYZFZSQTJ-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.10 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |