C33H33ClN2O2 — CID 174517932
4-(4-chlorophenyl)-3-[(4-cyclohexylphenoxy)methyl]-N-ethyl-N-pyridin-4-ylbenzamide (PubChem CID 174517932) has the molecular formula C33H33ClN2O2 and a molecular weight of 525.09 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-3-[(4-cyclohexylphenoxy)methyl]-N-ethyl-N-pyridin-4-ylbenzamide.
| Compound Name | 4-(4-chlorophenyl)-3-[(4-cyclohexylphenoxy)methyl]-N-ethyl-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 174517932 |
| Molecular Formula | C33H33ClN2O2 |
| Molecular Weight | 525.09 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | 4-(4-chlorophenyl)-3-[(4-cyclohexylphenoxy)methyl]-N-ethyl-N-pyridin-4-ylbenzamide |
| SMILES | CCN(C(=O)c1ccc(-c2ccc(Cl)cc2)c(COc2ccc(C3CCCCC3)cc2)c1)c1ccncc1 |
| InChI | InChI=1S/C33H33ClN2O2/c1-2-36(30-18-20-35-21-19-30)33(37)27-12-17-32(26-8-13-29(34)14-9-26)28(22-27)23-38-31-15-10-25(11-16-31)24-6-4-3-5-7-24/h8-22,24H,2-7,23H2,1H3 |
| InChIKey | PPIRVERFJNOMDC-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.09 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |