C32H31ClN2O2 — CID 174503750
4-(4-chlorophenyl)-3-[(4-cyclohexylphenoxy)methyl]-N-(pyridin-2-ylmethyl)benzamide (PubChem CID 174503750) has the molecular formula C32H31ClN2O2 and a molecular weight of 511.07 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-3-[(4-cyclohexylphenoxy)methyl]-N-(pyridin-2-ylmethyl)benzamide.
| Compound Name | 4-(4-chlorophenyl)-3-[(4-cyclohexylphenoxy)methyl]-N-(pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 174503750 |
| Molecular Formula | C32H31ClN2O2 |
| Molecular Weight | 511.07 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 4-(4-chlorophenyl)-3-[(4-cyclohexylphenoxy)methyl]-N-(pyridin-2-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccccn1)c1ccc(-c2ccc(Cl)cc2)c(COc2ccc(C3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C32H31ClN2O2/c33-28-14-9-25(10-15-28)31-18-13-26(32(36)35-21-29-8-4-5-19-34-29)20-27(31)22-37-30-16-11-24(12-17-30)23-6-2-1-3-7-23/h4-5,8-20,23H,1-3,6-7,21-22H2,(H,35,36) |
| InChIKey | JHJNJHNTJOBOGL-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.07 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |