C21H21ClO3 — CID 1327389
[2-(4-cyclohexylphenyl)-2-oxoethyl] 3-chlorobenzoate (PubChem CID 1327389) has the molecular formula C21H21ClO3 and a molecular weight of 356.85 g/mol. Its IUPAC name is [2-(4-cyclohexylphenyl)-2-oxoethyl] 3-chlorobenzoate.
| Compound Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 3-chlorobenzoate |
|---|---|
| PubChem CID | 1327389 |
| Molecular Formula | C21H21ClO3 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | [2-(4-cyclohexylphenyl)-2-oxoethyl] 3-chlorobenzoate |
| SMILES | O=C(COC(=O)c1cccc(Cl)c1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H21ClO3/c22-19-8-4-7-18(13-19)21(24)25-14-20(23)17-11-9-16(10-12-17)15-5-2-1-3-6-15/h4,7-13,15H,1-3,5-6,14H2 |
| InChIKey | BJXSLFYTNZHNLJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |