C26H25Cl2NO2 — CID 141030166
(3,5-dichlorophenyl) N-benzyl-N-(4-cyclohexylphenyl)carbamate (PubChem CID 141030166) has the molecular formula C26H25Cl2NO2 and a molecular weight of 454.40 g/mol. Its IUPAC name is (3,5-dichlorophenyl) N-benzyl-N-(4-cyclohexylphenyl)carbamate.
| Compound Name | (3,5-dichlorophenyl) N-benzyl-N-(4-cyclohexylphenyl)carbamate |
|---|---|
| PubChem CID | 141030166 |
| Molecular Formula | C26H25Cl2NO2 |
| Molecular Weight | 454.40 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | (3,5-dichlorophenyl) N-benzyl-N-(4-cyclohexylphenyl)carbamate |
| SMILES | O=C(Oc1cc(Cl)cc(Cl)c1)N(Cc1ccccc1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C26H25Cl2NO2/c27-22-15-23(28)17-25(16-22)31-26(30)29(18-19-7-3-1-4-8-19)24-13-11-21(12-14-24)20-9-5-2-6-10-20/h1,3-4,7-8,11-17,20H,2,5-6,9-10,18H2 |
| InChIKey | ZPFJNYODYBTIPV-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.40 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |