C27H36N2O — CID 90316604
N-(1-benzylpiperidin-4-yl)-N-(4-cyclohexylphenyl)propanamide (PubChem CID 90316604) has the molecular formula C27H36N2O and a molecular weight of 404.60 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-N-(4-cyclohexylphenyl)propanamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-N-(4-cyclohexylphenyl)propanamide |
|---|---|
| PubChem CID | 90316604 |
| Molecular Formula | C27H36N2O |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-N-(4-cyclohexylphenyl)propanamide |
| SMILES | CCC(=O)N(c1ccc(C2CCCCC2)cc1)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H36N2O/c1-2-27(30)29(25-15-13-24(14-16-25)23-11-7-4-8-12-23)26-17-19-28(20-18-26)21-22-9-5-3-6-10-22/h3,5-6,9-10,13-16,23,26H,2,4,7-8,11-12,17-21H2,1H3 |
| InChIKey | XKZGBNFDGRTQML-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |