C21H16ClNO4 — CID 140967749
phenyl N-(1,3-benzodioxol-5-ylmethyl)-N-(4-chlorophenyl)carbamate (PubChem CID 140967749) has the molecular formula C21H16ClNO4 and a molecular weight of 381.82 g/mol. Its IUPAC name is phenyl N-(1,3-benzodioxol-5-ylmethyl)-N-(4-chlorophenyl)carbamate.
| Compound Name | phenyl N-(1,3-benzodioxol-5-ylmethyl)-N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 140967749 |
| Molecular Formula | C21H16ClNO4 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | phenyl N-(1,3-benzodioxol-5-ylmethyl)-N-(4-chlorophenyl)carbamate |
| SMILES | O=C(Oc1ccccc1)N(Cc1ccc2c(c1)OCO2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H16ClNO4/c22-16-7-9-17(10-8-16)23(21(24)27-18-4-2-1-3-5-18)13-15-6-11-19-20(12-15)26-14-25-19/h1-12H,13-14H2 |
| InChIKey | BCFLLLRJNHNYOW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |