C23H21NO6S — CID 16574816
[4-[benzenesulfonyl(methyl)amino]phenyl] 3-(1,3-benzodioxol-5-yl)propanoate (PubChem CID 16574816) has the molecular formula C23H21NO6S and a molecular weight of 439.49 g/mol. Its IUPAC name is [4-[benzenesulfonyl(methyl)amino]phenyl] 3-(1,3-benzodioxol-5-yl)propanoate.
| Compound Name | [4-[benzenesulfonyl(methyl)amino]phenyl] 3-(1,3-benzodioxol-5-yl)propanoate |
|---|---|
| PubChem CID | 16574816 |
| Molecular Formula | C23H21NO6S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | [4-[benzenesulfonyl(methyl)amino]phenyl] 3-(1,3-benzodioxol-5-yl)propanoate |
| SMILES | CN(c1ccc(OC(=O)CCc2ccc3c(c2)OCO3)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H21NO6S/c1-24(31(26,27)20-5-3-2-4-6-20)18-9-11-19(12-10-18)30-23(25)14-8-17-7-13-21-22(15-17)29-16-28-21/h2-7,9-13,15H,8,14,16H2,1H3 |
| InChIKey | ZPBSKHOHVRNEPN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|