C16H14FNO3 — CID 56781359
N-(1,3-benzodioxol-5-ylmethyl)-N-(4-fluorophenyl)acetamide (PubChem CID 56781359) has the molecular formula C16H14FNO3 and a molecular weight of 287.29 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-(4-fluorophenyl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 56781359 |
| Molecular Formula | C16H14FNO3 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-(4-fluorophenyl)acetamide |
| SMILES | CC(=O)N(Cc1ccc2c(c1)OCO2)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H14FNO3/c1-11(19)18(14-5-3-13(17)4-6-14)9-12-2-7-15-16(8-12)21-10-20-15/h2-8H,9-10H2,1H3 |
| InChIKey | WAVNOOHXVNRDSS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |