C16H14N4O3 — CID 135051932
1-(1,3-benzodioxol-5-ylmethyl)-3-diazo-1-(4-methylphenyl)urea (PubChem CID 135051932) has the molecular formula C16H14N4O3 and a molecular weight of 310.31 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-diazo-1-(4-methylphenyl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-diazo-1-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 135051932 |
| Molecular Formula | C16H14N4O3 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-diazo-1-(4-methylphenyl)urea |
| SMILES | Cc1ccc(N(Cc2ccc3c(c2)OCO3)C(=O)N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C16H14N4O3/c1-11-2-5-13(6-3-11)20(16(21)18-19-17)9-12-4-7-14-15(8-12)23-10-22-14/h2-8H,9-10H2,1H3 |
| InChIKey | QSSWQVYJRDPOQF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 87.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|