C19H13FN2O6 — CID 99804713
N-(1,3-benzodioxol-5-ylmethyl)-N-(4-fluorophenyl)-5-nitrofuran-2-carboxamide (PubChem CID 99804713) has the molecular formula C19H13FN2O6 and a molecular weight of 384.32 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-(4-fluorophenyl)-5-nitrofuran-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-(4-fluorophenyl)-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 99804713 |
| Molecular Formula | C19H13FN2O6 |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-(4-fluorophenyl)-5-nitrofuran-2-carboxamide |
| SMILES | O=C(c1ccc([N+](=O)[O-])o1)N(Cc1ccc2c(c1)OCO2)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H13FN2O6/c20-13-2-4-14(5-3-13)21(19(23)16-7-8-18(28-16)22(24)25)10-12-1-6-15-17(9-12)27-11-26-15/h1-9H,10-11H2 |
| InChIKey | FXJJSLPZKCLXSN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 95.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|