C20H13FIN3O5 — CID 2237872
N-[(4-fluorophenyl)methyl]-N-(4-iodophenyl)-3,5-dinitrobenzamide (PubChem CID 2237872) has the molecular formula C20H13FIN3O5 and a molecular weight of 521.24 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-(4-iodophenyl)-3,5-dinitrobenzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-(4-iodophenyl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 2237872 |
| Molecular Formula | C20H13FIN3O5 |
| Molecular Weight | 521.24 g/mol |
| Exact Mass | 520.99 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-(4-iodophenyl)-3,5-dinitrobenzamide |
| SMILES | O=C(c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)N(Cc1ccc(F)cc1)c1ccc(I)cc1 |
| InChI | InChI=1S/C20H13FIN3O5/c21-15-3-1-13(2-4-15)12-23(17-7-5-16(22)6-8-17)20(26)14-9-18(24(27)28)11-19(10-14)25(29)30/h1-11H,12H2 |
| InChIKey | CHHBRMSFDYFVEQ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.24 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|