C24H20ClNO6 — CID 14882837
4-[3-[N-(1,3-benzodioxole-5-carbonyl)-4-chloroanilino]propoxy]benzoic acid (PubChem CID 14882837) has the molecular formula C24H20ClNO6 and a molecular weight of 453.88 g/mol. Its IUPAC name is 4-[3-[N-(1,3-benzodioxole-5-carbonyl)-4-chloroanilino]propoxy]benzoic acid.
| Compound Name | 4-[3-[N-(1,3-benzodioxole-5-carbonyl)-4-chloroanilino]propoxy]benzoic acid |
|---|---|
| PubChem CID | 14882837 |
| Molecular Formula | C24H20ClNO6 |
| Molecular Weight | 453.88 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 4-[3-[N-(1,3-benzodioxole-5-carbonyl)-4-chloroanilino]propoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCCCN(C(=O)c2ccc3c(c2)OCO3)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H20ClNO6/c25-18-5-7-19(8-6-18)26(23(27)17-4-11-21-22(14-17)32-15-31-21)12-1-13-30-20-9-2-16(3-10-20)24(28)29/h2-11,14H,1,12-13,15H2,(H,28,29) |
| InChIKey | RLQJPUMIEWWVNC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.88 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|