C18H18ClNO4 — CID 55898097
N-[3-(4-chlorophenoxy)propyl]-N-methyl-1,3-benzodioxole-4-carboxamide (PubChem CID 55898097) has the molecular formula C18H18ClNO4 and a molecular weight of 347.80 g/mol. Its IUPAC name is N-[3-(4-chlorophenoxy)propyl]-N-methyl-1,3-benzodioxole-4-carboxamide.
| Compound Name | N-[3-(4-chlorophenoxy)propyl]-N-methyl-1,3-benzodioxole-4-carboxamide |
|---|---|
| PubChem CID | 55898097 |
| Molecular Formula | C18H18ClNO4 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N-[3-(4-chlorophenoxy)propyl]-N-methyl-1,3-benzodioxole-4-carboxamide |
| SMILES | CN(CCCOc1ccc(Cl)cc1)C(=O)c1cccc2c1OCO2 |
| InChI | InChI=1S/C18H18ClNO4/c1-20(10-3-11-22-14-8-6-13(19)7-9-14)18(21)15-4-2-5-16-17(15)24-12-23-16/h2,4-9H,3,10-12H2,1H3 |
| InChIKey | CVNQVBPMEKNINU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|