C28H26ClNO2 — CID 141030230
N-benzyl-5-chloro-N-(4-cyclohexylphenyl)-1-benzofuran-2-carboxamide (PubChem CID 141030230) has the molecular formula C28H26ClNO2 and a molecular weight of 443.97 g/mol. Its IUPAC name is N-benzyl-5-chloro-N-(4-cyclohexylphenyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-benzyl-5-chloro-N-(4-cyclohexylphenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 141030230 |
| Molecular Formula | C28H26ClNO2 |
| Molecular Weight | 443.97 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | N-benzyl-5-chloro-N-(4-cyclohexylphenyl)-1-benzofuran-2-carboxamide |
| SMILES | O=C(c1cc2cc(Cl)ccc2o1)N(Cc1ccccc1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C28H26ClNO2/c29-24-13-16-26-23(17-24)18-27(32-26)28(31)30(19-20-7-3-1-4-8-20)25-14-11-22(12-15-25)21-9-5-2-6-10-21/h1,3-4,7-8,11-18,21H,2,5-6,9-10,19H2 |
| InChIKey | RYXMJTCOTHPIAE-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.97 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |