C29H31ClN2O3 — CID 67483835
4-[[N-[[(1S)-1-(4-chlorophenyl)ethyl]carbamoyl]-4-cyclohexylanilino]methyl]benzoic acid (PubChem CID 67483835) has the molecular formula C29H31ClN2O3 and a molecular weight of 491.03 g/mol. Its IUPAC name is 4-[[N-[[(1S)-1-(4-chlorophenyl)ethyl]carbamoyl]-4-cyclohexylanilino]methyl]benzoic acid.
| Compound Name | 4-[[N-[[(1S)-1-(4-chlorophenyl)ethyl]carbamoyl]-4-cyclohexylanilino]methyl]benzoic acid |
|---|---|
| PubChem CID | 67483835 |
| Molecular Formula | C29H31ClN2O3 |
| Molecular Weight | 491.03 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 4-[[N-[[(1S)-1-(4-chlorophenyl)ethyl]carbamoyl]-4-cyclohexylanilino]methyl]benzoic acid |
| SMILES | C[C@H](NC(=O)N(Cc1ccc(C(=O)O)cc1)c1ccc(C2CCCCC2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H31ClN2O3/c1-20(22-11-15-26(30)16-12-22)31-29(35)32(19-21-7-9-25(10-8-21)28(33)34)27-17-13-24(14-18-27)23-5-3-2-4-6-23/h7-18,20,23H,2-6,19H2,1H3,(H,31,35)(H,33,34)/t20-/m0/s1 |
| InChIKey | REMHJNCMJXOJKA-FQEVSTJZSA-N |
| XLogP | 7.56 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.03 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |