About 2-cyclohexylguanidine;dihydroxy(dioxo)chromium
2-cyclohexylguanidine;dihydroxy(dioxo)chromium (PubChem CID 158817655) has the molecular formula C7H17CrN3O4
and a molecular weight of 259.23 g/mol. Its IUPAC name is 2-cyclohexylguanidine;dihydroxy(dioxo)chromium.
Molecular Properties
| Compound Name | 2-cyclohexylguanidine;dihydroxy(dioxo)chromium |
| PubChem CID | 158817655 |
| Molecular Formula | C7H17CrN3O4 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 2-cyclohexylguanidine;dihydroxy(dioxo)chromium |
| SMILES | NC(N)=NC1CCCCC1.O=[Cr](=O)(O)O |
| InChI | InChI=1S/C7H15N3.Cr.2H2O.2O/c8-7(9)10-6-4-2-1-3-5-6;;;;;/h6H,1-5H2,(H4,8,9,10);;2*1H2;;/q;+2;;;;/p-2 |
| InChIKey | IVLUXTNBFKKWBQ-UHFFFAOYSA-L |
| XLogP | -0.76 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexylguanidine;dihydroxy(dioxo)chromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylguanidine;dihydroxy(dioxo)chromium?
The IUPAC name of 2-cyclohexylguanidine;dihydroxy(dioxo)chromium (CID 158817655) is 2-cyclohexylguanidine;dihydroxy(dioxo)chromium.
What is the SMILES notation for 2-cyclohexylguanidine;dihydroxy(dioxo)chromium?
The canonical SMILES for 2-cyclohexylguanidine;dihydroxy(dioxo)chromium is NC(N)=NC1CCCCC1.O=[Cr](=O)(O)O.
What is the InChIKey of 2-cyclohexylguanidine;dihydroxy(dioxo)chromium?
The InChIKey is IVLUXTNBFKKWBQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H15N3.Cr.2H2O.2O/c8-7(9)10-6-4-2-1-3-5-6;;;;;/h6H,1-5H2,(H4,8,9,10);;2*1H2;;/q;+2;;;;/p-2.
What are the key properties of 2-cyclohexylguanidine;dihydroxy(dioxo)chromium?
2-cyclohexylguanidine;dihydroxy(dioxo)chromium has a molecular weight of 259.23 g/mol, XLogP of -0.76, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylguanidine;dihydroxy(dioxo)chromium is sourced from PubChem (CID 158817655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).