C7H14N4O2 — CID 77306150
3-(diaminomethylideneamino)piperidine-1-carboxylic acid (PubChem CID 77306150) has the molecular formula C7H14N4O2 and a molecular weight of 186.21 g/mol. Its IUPAC name is 3-(diaminomethylideneamino)piperidine-1-carboxylic acid.
| Compound Name | 3-(diaminomethylideneamino)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 77306150 |
| Molecular Formula | C7H14N4O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | 3-(diaminomethylideneamino)piperidine-1-carboxylic acid |
| SMILES | NC(N)=NC1CCCN(C(=O)O)C1 |
| InChI | InChI=1S/C7H14N4O2/c8-6(9)10-5-2-1-3-11(4-5)7(12)13/h5H,1-4H2,(H,12,13)(H4,8,9,10) |
| InChIKey | HKLLRRCAZDDHEI-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|