C8H16N4O2S — CID 175599369
(3R)-3-[[hydrazinyl(methylsulfanyl)methylidene]amino]piperidine-1-carboxylic acid (PubChem CID 175599369) has the molecular formula C8H16N4O2S and a molecular weight of 232.31 g/mol. Its IUPAC name is (3R)-3-[[hydrazinyl(methylsulfanyl)methylidene]amino]piperidine-1-carboxylic acid.
| Compound Name | (3R)-3-[[hydrazinyl(methylsulfanyl)methylidene]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175599369 |
| Molecular Formula | C8H16N4O2S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | (3R)-3-[[hydrazinyl(methylsulfanyl)methylidene]amino]piperidine-1-carboxylic acid |
| SMILES | CS/C(=N\[C@@H]1CCCN(C(=O)O)C1)NN |
| InChI | InChI=1S/C8H16N4O2S/c1-15-7(11-9)10-6-3-2-4-12(5-6)8(13)14/h6H,2-5,9H2,1H3,(H,10,11)(H,13,14)/t6-/m1/s1 |
| InChIKey | FQGDAXJBJAIWSW-ZCFIWIBFSA-N |
| XLogP | 0.31 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|