C11H23ClN4O2 — CID 67427139
tert-butyl 3-(diaminomethylideneamino)piperidine-1-carboxylate;hydrochloride (PubChem CID 67427139) has the molecular formula C11H23ClN4O2 and a molecular weight of 278.78 g/mol. Its IUPAC name is tert-butyl 3-(diaminomethylideneamino)piperidine-1-carboxylate;hydrochloride.
| Compound Name | tert-butyl 3-(diaminomethylideneamino)piperidine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 67427139 |
| Molecular Formula | C11H23ClN4O2 |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | tert-butyl 3-(diaminomethylideneamino)piperidine-1-carboxylate;hydrochloride |
| SMILES | CC(C)(C)OC(=O)N1CCCC(N=C(N)N)C1.Cl |
| InChI | InChI=1S/C11H22N4O2.ClH/c1-11(2,3)17-10(16)15-6-4-5-8(7-15)14-9(12)13;/h8H,4-7H2,1-3H3,(H4,12,13,14);1H |
| InChIKey | CZAPXVBBFSZXKT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|