C12H22N2O3 — CID 156540665
tert-butyl (3S)-3-(2-amino-2-oxoethyl)piperidine-1-carboxylate (PubChem CID 156540665) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is tert-butyl (3S)-3-(2-amino-2-oxoethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(2-amino-2-oxoethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 156540665 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | tert-butyl (3S)-3-(2-amino-2-oxoethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](CC(N)=O)C1 |
| InChI | InChI=1S/C12H22N2O3/c1-12(2,3)17-11(16)14-6-4-5-9(8-14)7-10(13)15/h9H,4-8H2,1-3H3,(H2,13,15)/t9-/m0/s1 |
| InChIKey | BOMFQWSXYDNMRZ-VIFPVBQESA-N |
| XLogP | 1.51 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |