C13H24N2O3 — CID 82380599
tert-butyl 3-(3-amino-2-oxopropyl)piperidine-1-carboxylate (PubChem CID 82380599) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is tert-butyl 3-(3-amino-2-oxopropyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(3-amino-2-oxopropyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 82380599 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | tert-butyl 3-(3-amino-2-oxopropyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(CC(=O)CN)C1 |
| InChI | InChI=1S/C13H24N2O3/c1-13(2,3)18-12(17)15-6-4-5-10(9-15)7-11(16)8-14/h10H,4-9,14H2,1-3H3 |
| InChIKey | UMDHFMOWBLGNAC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |