C16H27NO5 — CID 24730344
tert-butyl 3-(4-ethoxy-2,4-dioxobutyl)piperidine-1-carboxylate (PubChem CID 24730344) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is tert-butyl 3-(4-ethoxy-2,4-dioxobutyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-ethoxy-2,4-dioxobutyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24730344 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | tert-butyl 3-(4-ethoxy-2,4-dioxobutyl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)CC(=O)CC1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H27NO5/c1-5-21-14(19)10-13(18)9-12-7-6-8-17(11-12)15(20)22-16(2,3)4/h12H,5-11H2,1-4H3 |
| InChIKey | HHVDKVQKNFEGQI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|