C18H36N2O2S — CID 103702169
tert-butyl 3-[[(2-ethyl-2-methylsulfanylbutyl)amino]methyl]piperidine-1-carboxylate (PubChem CID 103702169) has the molecular formula C18H36N2O2S and a molecular weight of 344.57 g/mol. Its IUPAC name is tert-butyl 3-[[(2-ethyl-2-methylsulfanylbutyl)amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[(2-ethyl-2-methylsulfanylbutyl)amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 103702169 |
| Molecular Formula | C18H36N2O2S |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | tert-butyl 3-[[(2-ethyl-2-methylsulfanylbutyl)amino]methyl]piperidine-1-carboxylate |
| SMILES | CCC(CC)(CNCC1CCCN(C(=O)OC(C)(C)C)C1)SC |
| InChI | InChI=1S/C18H36N2O2S/c1-7-18(8-2,23-6)14-19-12-15-10-9-11-20(13-15)16(21)22-17(3,4)5/h15,19H,7-14H2,1-6H3 |
| InChIKey | NFWWLDALWZOIOJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |