C20H27NO8 — CID 15893083
trimethyl 4-acetyl-1-cyclohexylimino-5-oxohex-1-ene-1,2,3-tricarboxylate (PubChem CID 15893083) has the molecular formula C20H27NO8 and a molecular weight of 409.44 g/mol. Its IUPAC name is trimethyl 4-acetyl-1-cyclohexylimino-5-oxohex-1-ene-1,2,3-tricarboxylate.
| Compound Name | trimethyl 4-acetyl-1-cyclohexylimino-5-oxohex-1-ene-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 15893083 |
| Molecular Formula | C20H27NO8 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | trimethyl 4-acetyl-1-cyclohexylimino-5-oxohex-1-ene-1,2,3-tricarboxylate |
| SMILES | COC(=O)C(=C=NC1CCCCC1)C(C(=O)OC)C(C(C)=O)(C(C)=O)C(=O)OC |
| InChI | InChI=1S/C20H27NO8/c1-12(22)20(13(2)23,19(26)29-5)16(18(25)28-4)15(17(24)27-3)11-21-14-9-7-6-8-10-14/h14,16H,6-10H2,1-5H3 |
| InChIKey | DWPZKVQIUZBDAA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 125.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|