C28H29NO6 — CID 15255379
dimethyl 2-(cyclohexyliminomethylidene)-3-(1,3-dioxo-1,3-diphenylpropan-2-yl)butanedioate (PubChem CID 15255379) has the molecular formula C28H29NO6 and a molecular weight of 475.54 g/mol. Its IUPAC name is dimethyl 2-(cyclohexyliminomethylidene)-3-(1,3-dioxo-1,3-diphenylpropan-2-yl)butanedioate.
| Compound Name | dimethyl 2-(cyclohexyliminomethylidene)-3-(1,3-dioxo-1,3-diphenylpropan-2-yl)butanedioate |
|---|---|
| PubChem CID | 15255379 |
| Molecular Formula | C28H29NO6 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | dimethyl 2-(cyclohexyliminomethylidene)-3-(1,3-dioxo-1,3-diphenylpropan-2-yl)butanedioate |
| SMILES | COC(=O)C(=C=NC1CCCCC1)C(C(=O)OC)C(C(=O)c1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C28H29NO6/c1-34-27(32)22(18-29-21-16-10-5-11-17-21)23(28(33)35-2)24(25(30)19-12-6-3-7-13-19)26(31)20-14-8-4-9-15-20/h3-4,6-9,12-15,21,23-24H,5,10-11,16-17H2,1-2H3 |
| InChIKey | GZWUKBYRROWPIB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 99.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|