C16H28N2O — CID 142827484
N,N'-dicyclohexylmethanediimine;propan-2-one (PubChem CID 142827484) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is N,N'-dicyclohexylmethanediimine;propan-2-one.
| Compound Name | N,N'-dicyclohexylmethanediimine;propan-2-one |
|---|---|
| PubChem CID | 142827484 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | N,N'-dicyclohexylmethanediimine;propan-2-one |
| SMILES | C(=NC1CCCCC1)=NC1CCCCC1.CC(C)=O |
| InChI | InChI=1S/C13H22N2.C3H6O/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;1-3(2)4/h12-13H,1-10H2;1-2H3 |
| InChIKey | ULRGXCNDESCFDH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|