C13H24N2Pb — CID 174956509
N,N'-dicyclohexylmethanediimine;λ2-plumbane (PubChem CID 174956509) has the molecular formula C13H24N2Pb and a molecular weight of 415.55 g/mol. Its IUPAC name is N,N'-dicyclohexylmethanediimine;λ2-plumbane.
| Compound Name | N,N'-dicyclohexylmethanediimine;λ2-plumbane |
|---|---|
| PubChem CID | 174956509 |
| Molecular Formula | C13H24N2Pb |
| Molecular Weight | 415.55 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | N,N'-dicyclohexylmethanediimine;λ2-plumbane |
| SMILES | C(=NC1CCCCC1)=NC1CCCCC1.[PbH2] |
| InChI | InChI=1S/C13H22N2.Pb.2H/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;;;/h12-13H,1-10H2;;; |
| InChIKey | KWDXKYNJAFMFQM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.55 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|