About lithium;N,N'-dicyclohexylmethanediimine;thiocyanate
lithium;N,N'-dicyclohexylmethanediimine;thiocyanate (PubChem CID 87293630) has the molecular formula C14H22LiN3S
and a molecular weight of 271.36 g/mol. Its IUPAC name is lithium;N,N'-dicyclohexylmethanediimine;thiocyanate.
Molecular Properties
| Compound Name | lithium;N,N'-dicyclohexylmethanediimine;thiocyanate |
| PubChem CID | 87293630 |
| Molecular Formula | C14H22LiN3S |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | lithium;N,N'-dicyclohexylmethanediimine;thiocyanate |
| SMILES | C(=NC1CCCCC1)=NC1CCCCC1.N#C[S-].[Li+] |
| InChI | InChI=1S/C13H22N2.CHNS.Li/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;2-1-3;/h12-13H,1-10H2;3H;/q;;+1/p-1 |
| InChIKey | UOSIJCQJYFUWJY-UHFFFAOYSA-M |
| XLogP | 0.84 |
| TPSA | 48.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze lithium;N,N'-dicyclohexylmethanediimine;thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;N,N'-dicyclohexylmethanediimine;thiocyanate?
The IUPAC name of lithium;N,N'-dicyclohexylmethanediimine;thiocyanate (CID 87293630) is lithium;N,N'-dicyclohexylmethanediimine;thiocyanate.
What is the SMILES notation for lithium;N,N'-dicyclohexylmethanediimine;thiocyanate?
The canonical SMILES for lithium;N,N'-dicyclohexylmethanediimine;thiocyanate is C(=NC1CCCCC1)=NC1CCCCC1.N#C[S-].[Li+].
What is the InChIKey of lithium;N,N'-dicyclohexylmethanediimine;thiocyanate?
The InChIKey is UOSIJCQJYFUWJY-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H22N2.CHNS.Li/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;2-1-3;/h12-13H,1-10H2;3H;/q;;+1/p-1.
What are the key properties of lithium;N,N'-dicyclohexylmethanediimine;thiocyanate?
lithium;N,N'-dicyclohexylmethanediimine;thiocyanate has a molecular weight of 271.36 g/mol, XLogP of 0.84, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;N,N'-dicyclohexylmethanediimine;thiocyanate is sourced from PubChem (CID 87293630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).