About N,N'-dicyclohexylmethanediimine;isocyanic acid
N,N'-dicyclohexylmethanediimine;isocyanic acid (PubChem CID 87197010) has the molecular formula C14H23N3O
and a molecular weight of 249.36 g/mol. Its IUPAC name is N,N'-dicyclohexylmethanediimine;isocyanic acid.
Molecular Properties
| Compound Name | N,N'-dicyclohexylmethanediimine;isocyanic acid |
| PubChem CID | 87197010 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N,N'-dicyclohexylmethanediimine;isocyanic acid |
| SMILES | C(=NC1CCCCC1)=NC1CCCCC1.N=C=O |
| InChI | InChI=1S/C13H22N2.CHNO/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;2-1-3/h12-13H,1-10H2;2H |
| InChIKey | ORAIOWPLELDKKY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dicyclohexylmethanediimine;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dicyclohexylmethanediimine;isocyanic acid?
The IUPAC name of N,N'-dicyclohexylmethanediimine;isocyanic acid (CID 87197010) is N,N'-dicyclohexylmethanediimine;isocyanic acid.
What is the SMILES notation for N,N'-dicyclohexylmethanediimine;isocyanic acid?
The canonical SMILES for N,N'-dicyclohexylmethanediimine;isocyanic acid is C(=NC1CCCCC1)=NC1CCCCC1.N=C=O.
What is the InChIKey of N,N'-dicyclohexylmethanediimine;isocyanic acid?
The InChIKey is ORAIOWPLELDKKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2.CHNO/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;2-1-3/h12-13H,1-10H2;2H.
What are the key properties of N,N'-dicyclohexylmethanediimine;isocyanic acid?
N,N'-dicyclohexylmethanediimine;isocyanic acid has a molecular weight of 249.36 g/mol, XLogP of 3.73, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dicyclohexylmethanediimine;isocyanic acid is sourced from PubChem (CID 87197010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).