About N,N'-dicyclohexylmethanediimine;4-methylmorpholine
N,N'-dicyclohexylmethanediimine;4-methylmorpholine (PubChem CID 174388370) has the molecular formula C18H33N3O
and a molecular weight of 307.48 g/mol. Its IUPAC name is N,N'-dicyclohexylmethanediimine;4-methylmorpholine.
Molecular Properties
| Compound Name | N,N'-dicyclohexylmethanediimine;4-methylmorpholine |
| PubChem CID | 174388370 |
| Molecular Formula | C18H33N3O |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.26 |
| IUPAC Name | N,N'-dicyclohexylmethanediimine;4-methylmorpholine |
| SMILES | C(=NC1CCCCC1)=NC1CCCCC1.CN1CCOCC1 |
| InChI | InChI=1S/C13H22N2.C5H11NO/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;1-6-2-4-7-5-3-6/h12-13H,1-10H2;2-5H2,1H3 |
| InChIKey | ZKJQZMNHKRHOHD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dicyclohexylmethanediimine;4-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dicyclohexylmethanediimine;4-methylmorpholine?
The IUPAC name of N,N'-dicyclohexylmethanediimine;4-methylmorpholine (CID 174388370) is N,N'-dicyclohexylmethanediimine;4-methylmorpholine.
What is the SMILES notation for N,N'-dicyclohexylmethanediimine;4-methylmorpholine?
The canonical SMILES for N,N'-dicyclohexylmethanediimine;4-methylmorpholine is C(=NC1CCCCC1)=NC1CCCCC1.CN1CCOCC1.
What is the InChIKey of N,N'-dicyclohexylmethanediimine;4-methylmorpholine?
The InChIKey is ZKJQZMNHKRHOHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2.C5H11NO/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;1-6-2-4-7-5-3-6/h12-13H,1-10H2;2-5H2,1H3.
What are the key properties of N,N'-dicyclohexylmethanediimine;4-methylmorpholine?
N,N'-dicyclohexylmethanediimine;4-methylmorpholine has a molecular weight of 307.48 g/mol, XLogP of 3.77, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dicyclohexylmethanediimine;4-methylmorpholine is sourced from PubChem (CID 174388370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).