C18H33N3O — CID 174388370
N,N'-dicyclohexylmethanediimine;4-methylmorpholine (PubChem CID 174388370) has the molecular formula C18H33N3O and a molecular weight of 307.48 g/mol. Its IUPAC name is N,N'-dicyclohexylmethanediimine;4-methylmorpholine.
| Compound Name | N,N'-dicyclohexylmethanediimine;4-methylmorpholine |
|---|---|
| PubChem CID | 174388370 |
| Molecular Formula | C18H33N3O |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.26 |
| IUPAC Name | N,N'-dicyclohexylmethanediimine;4-methylmorpholine |
| SMILES | C(=NC1CCCCC1)=NC1CCCCC1.CN1CCOCC1 |
| InChI | InChI=1S/C13H22N2.C5H11NO/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;1-6-2-4-7-5-3-6/h12-13H,1-10H2;2-5H2,1H3 |
| InChIKey | ZKJQZMNHKRHOHD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|