C13H23N2Na — CID 175020266
sodium;N,N'-dicyclohexylmethanediimine;hydride (PubChem CID 175020266) has the molecular formula C13H23N2Na and a molecular weight of 230.33 g/mol. Its IUPAC name is sodium;N,N'-dicyclohexylmethanediimine;hydride.
| Compound Name | sodium;N,N'-dicyclohexylmethanediimine;hydride |
|---|---|
| PubChem CID | 175020266 |
| Molecular Formula | C13H23N2Na |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | sodium;N,N'-dicyclohexylmethanediimine;hydride |
| SMILES | C(=NC1CCCCC1)=NC1CCCCC1.[H-].[Na+] |
| InChI | InChI=1S/C13H22N2.Na.H/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;;/h12-13H,1-10H2;;/q;+1;-1 |
| InChIKey | VFTGFGQBIBXDPR-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|