C23H42Cl3N3O2 — CID 88510000
N,N'-dicyclohexylmethanediimine;N-ethyl-N-propan-2-ylpropan-2-amine;2,2,2-trichloroacetic acid (PubChem CID 88510000) has the molecular formula C23H42Cl3N3O2 and a molecular weight of 498.97 g/mol. Its IUPAC name is N,N'-dicyclohexylmethanediimine;N-ethyl-N-propan-2-ylpropan-2-amine;2,2,2-trichloroacetic acid.
| Compound Name | N,N'-dicyclohexylmethanediimine;N-ethyl-N-propan-2-ylpropan-2-amine;2,2,2-trichloroacetic acid |
|---|---|
| PubChem CID | 88510000 |
| Molecular Formula | C23H42Cl3N3O2 |
| Molecular Weight | 498.97 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | N,N'-dicyclohexylmethanediimine;N-ethyl-N-propan-2-ylpropan-2-amine;2,2,2-trichloroacetic acid |
| SMILES | C(=NC1CCCCC1)=NC1CCCCC1.CCN(C(C)C)C(C)C.O=C(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H22N2.C8H19N.C2HCl3O2/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;1-6-9(7(2)3)8(4)5;3-2(4,5)1(6)7/h12-13H,1-10H2;7-8H,6H2,1-5H3;(H,6,7) |
| InChIKey | QNHVAESULVPXOP-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.97 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|