About N-ethyl-N-propan-2-ylpropan-2-amine;trihydrofluoride
N-ethyl-N-propan-2-ylpropan-2-amine;trihydrofluoride (PubChem CID 45108321) has the molecular formula C8H22F3N
and a molecular weight of 189.26 g/mol. Its IUPAC name is N-ethyl-N-propan-2-ylpropan-2-amine;trihydrofluoride.
Molecular Properties
| Compound Name | N-ethyl-N-propan-2-ylpropan-2-amine;trihydrofluoride |
| PubChem CID | 45108321 |
| Molecular Formula | C8H22F3N |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | N-ethyl-N-propan-2-ylpropan-2-amine;trihydrofluoride |
| SMILES | CCN(C(C)C)C(C)C.F.F.F |
| InChI | InChI=1S/C8H19N.3FH/c1-6-9(7(2)3)8(4)5;;;/h7-8H,6H2,1-5H3;3*1H |
| InChIKey | AJRRXKJZYYBJPY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-N-propan-2-ylpropan-2-amine;trihydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-propan-2-ylpropan-2-amine;trihydrofluoride?
The IUPAC name of N-ethyl-N-propan-2-ylpropan-2-amine;trihydrofluoride (CID 45108321) is N-ethyl-N-propan-2-ylpropan-2-amine;trihydrofluoride.
What is the SMILES notation for N-ethyl-N-propan-2-ylpropan-2-amine;trihydrofluoride?
The canonical SMILES for N-ethyl-N-propan-2-ylpropan-2-amine;trihydrofluoride is CCN(C(C)C)C(C)C.F.F.F.
What is the InChIKey of N-ethyl-N-propan-2-ylpropan-2-amine;trihydrofluoride?
The InChIKey is AJRRXKJZYYBJPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.3FH/c1-6-9(7(2)3)8(4)5;;;/h7-8H,6H2,1-5H3;3*1H.
What are the key properties of N-ethyl-N-propan-2-ylpropan-2-amine;trihydrofluoride?
N-ethyl-N-propan-2-ylpropan-2-amine;trihydrofluoride has a molecular weight of 189.26 g/mol, XLogP of 2.58, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-propan-2-ylpropan-2-amine;trihydrofluoride is sourced from PubChem (CID 45108321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).