C24H46ClN3O2 — CID 157084875
N,N'-dicyclohexylmethanediimine;N,N-diethylethanamine;2-methylpropyl carbonochloridate (PubChem CID 157084875) has the molecular formula C24H46ClN3O2 and a molecular weight of 444.10 g/mol. Its IUPAC name is N,N'-dicyclohexylmethanediimine;N,N-diethylethanamine;2-methylpropyl carbonochloridate.
| Compound Name | N,N'-dicyclohexylmethanediimine;N,N-diethylethanamine;2-methylpropyl carbonochloridate |
|---|---|
| PubChem CID | 157084875 |
| Molecular Formula | C24H46ClN3O2 |
| Molecular Weight | 444.10 g/mol |
| Exact Mass | 443.33 |
| IUPAC Name | N,N'-dicyclohexylmethanediimine;N,N-diethylethanamine;2-methylpropyl carbonochloridate |
| SMILES | C(=NC1CCCCC1)=NC1CCCCC1.CC(C)COC(=O)Cl.CCN(CC)CC |
| InChI | InChI=1S/C13H22N2.C6H15N.C5H9ClO2/c1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13;1-4-7(5-2)6-3;1-4(2)3-8-5(6)7/h12-13H,1-10H2;4-6H2,1-3H3;4H,3H2,1-2H3 |
| InChIKey | ADYZDUWPXMYCGJ-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.10 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|