C6H10N2O4 — CID 54102019
2,3-bis(methoxyimino)butanoic acid (PubChem CID 54102019) has the molecular formula C6H10N2O4 and a molecular weight of 174.16 g/mol. Its IUPAC name is 2,3-bis(methoxyimino)butanoic acid.
| Compound Name | 2,3-bis(methoxyimino)butanoic acid |
|---|---|
| PubChem CID | 54102019 |
| Molecular Formula | C6H10N2O4 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 2,3-bis(methoxyimino)butanoic acid |
| SMILES | CON=C(C)C(=NOC)C(=O)O |
| InChI | InChI=1S/C6H10N2O4/c1-4(7-11-2)5(6(9)10)8-12-3/h1-3H3,(H,9,10) |
| InChIKey | NBDPFQKUZIQRNS-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|