About (2E)-2-methoxyimino-N-methylpropanamide;methyl (2E)-2-methoxyiminopropanoate
(2E)-2-methoxyimino-N-methylpropanamide;methyl (2E)-2-methoxyiminopropanoate (PubChem CID 172959290) has the molecular formula C10H19N3O5
and a molecular weight of 261.28 g/mol. Its IUPAC name is (2E)-2-methoxyimino-N-methylpropanamide;methyl (2E)-2-methoxyiminopropanoate.
Molecular Properties
| Compound Name | (2E)-2-methoxyimino-N-methylpropanamide;methyl (2E)-2-methoxyiminopropanoate |
| PubChem CID | 172959290 |
| Molecular Formula | C10H19N3O5 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | (2E)-2-methoxyimino-N-methylpropanamide;methyl (2E)-2-methoxyiminopropanoate |
| SMILES | CNC(=O)/C(C)=N/OC.CO/N=C(\C)C(=O)OC |
| InChI | InChI=1S/C5H10N2O2.C5H9NO3/c1-4(7-9-3)5(8)6-2;1-4(6-9-3)5(7)8-2/h1-3H3,(H,6,8);1-3H3/b7-4+;6-4+ |
| InChIKey | LCVYWQHLDPZTOJ-CFLLHFHGSA-N |
| XLogP | -0.06 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-methoxyimino-N-methylpropanamide;methyl (2E)-2-methoxyiminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-methoxyimino-N-methylpropanamide;methyl (2E)-2-methoxyiminopropanoate?
The IUPAC name of (2E)-2-methoxyimino-N-methylpropanamide;methyl (2E)-2-methoxyiminopropanoate (CID 172959290) is (2E)-2-methoxyimino-N-methylpropanamide;methyl (2E)-2-methoxyiminopropanoate.
What is the SMILES notation for (2E)-2-methoxyimino-N-methylpropanamide;methyl (2E)-2-methoxyiminopropanoate?
The canonical SMILES for (2E)-2-methoxyimino-N-methylpropanamide;methyl (2E)-2-methoxyiminopropanoate is CNC(=O)/C(C)=N/OC.CO/N=C(\C)C(=O)OC.
What is the InChIKey of (2E)-2-methoxyimino-N-methylpropanamide;methyl (2E)-2-methoxyiminopropanoate?
The InChIKey is LCVYWQHLDPZTOJ-CFLLHFHGSA-N. The full InChI is InChI=1S/C5H10N2O2.C5H9NO3/c1-4(7-9-3)5(8)6-2;1-4(6-9-3)5(7)8-2/h1-3H3,(H,6,8);1-3H3/b7-4+;6-4+.
What are the key properties of (2E)-2-methoxyimino-N-methylpropanamide;methyl (2E)-2-methoxyiminopropanoate?
(2E)-2-methoxyimino-N-methylpropanamide;methyl (2E)-2-methoxyiminopropanoate has a molecular weight of 261.28 g/mol, XLogP of -0.06, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-methoxyimino-N-methylpropanamide;methyl (2E)-2-methoxyiminopropanoate is sourced from PubChem (CID 172959290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).