About bis(2-methoxyiminopropanoyloxy)indiganyl 2-methoxyiminopropanoate
bis(2-methoxyiminopropanoyloxy)indiganyl 2-methoxyiminopropanoate (PubChem CID 140789850) has the molecular formula C12H18InN3O9
and a molecular weight of 463.11 g/mol. Its IUPAC name is bis(2-methoxyiminopropanoyloxy)indiganyl 2-methoxyiminopropanoate.
Molecular Properties
| Compound Name | bis(2-methoxyiminopropanoyloxy)indiganyl 2-methoxyiminopropanoate |
| PubChem CID | 140789850 |
| Molecular Formula | C12H18InN3O9 |
| Molecular Weight | 463.11 g/mol |
| Exact Mass | 463.01 |
| IUPAC Name | bis(2-methoxyiminopropanoyloxy)indiganyl 2-methoxyiminopropanoate |
| SMILES | CON=C(C)C(=O)O[In](OC(=O)C(C)=NOC)OC(=O)C(C)=NOC |
| InChI | InChI=1S/3C4H7NO3.In/c3*1-3(4(6)7)5-8-2;/h3*1-2H3,(H,6,7);/q;;;+3/p-3 |
| InChIKey | FYRYVGMEFVLHRU-UHFFFAOYSA-K |
| XLogP | -0.33 |
| TPSA | 143.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.11 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methoxyiminopropanoyloxy)indiganyl 2-methoxyiminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methoxyiminopropanoyloxy)indiganyl 2-methoxyiminopropanoate?
The IUPAC name of bis(2-methoxyiminopropanoyloxy)indiganyl 2-methoxyiminopropanoate (CID 140789850) is bis(2-methoxyiminopropanoyloxy)indiganyl 2-methoxyiminopropanoate.
What is the SMILES notation for bis(2-methoxyiminopropanoyloxy)indiganyl 2-methoxyiminopropanoate?
The canonical SMILES for bis(2-methoxyiminopropanoyloxy)indiganyl 2-methoxyiminopropanoate is CON=C(C)C(=O)O[In](OC(=O)C(C)=NOC)OC(=O)C(C)=NOC.
What is the InChIKey of bis(2-methoxyiminopropanoyloxy)indiganyl 2-methoxyiminopropanoate?
The InChIKey is FYRYVGMEFVLHRU-UHFFFAOYSA-K. The full InChI is InChI=1S/3C4H7NO3.In/c3*1-3(4(6)7)5-8-2;/h3*1-2H3,(H,6,7);/q;;;+3/p-3.
What are the key properties of bis(2-methoxyiminopropanoyloxy)indiganyl 2-methoxyiminopropanoate?
bis(2-methoxyiminopropanoyloxy)indiganyl 2-methoxyiminopropanoate has a molecular weight of 463.11 g/mol, XLogP of -0.33, 9 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methoxyiminopropanoyloxy)indiganyl 2-methoxyiminopropanoate is sourced from PubChem (CID 140789850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).