About methyl 3-methoxyiminobutanoate
methyl 3-methoxyiminobutanoate (PubChem CID 72729968) has the molecular formula C6H11NO3
and a molecular weight of 145.16 g/mol. Its IUPAC name is methyl 3-methoxyiminobutanoate.
Molecular Properties
| Compound Name | methyl 3-methoxyiminobutanoate |
| PubChem CID | 72729968 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | methyl 3-methoxyiminobutanoate |
| SMILES | CON=C(C)CC(=O)OC |
| InChI | InChI=1S/C6H11NO3/c1-5(7-10-3)4-6(8)9-2/h4H2,1-3H3 |
| InChIKey | PQYHCBWMKLAMRP-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-methoxyiminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-methoxyiminobutanoate?
The IUPAC name of methyl 3-methoxyiminobutanoate (CID 72729968) is methyl 3-methoxyiminobutanoate.
What is the SMILES notation for methyl 3-methoxyiminobutanoate?
The canonical SMILES for methyl 3-methoxyiminobutanoate is CON=C(C)CC(=O)OC.
What is the InChIKey of methyl 3-methoxyiminobutanoate?
The InChIKey is PQYHCBWMKLAMRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3/c1-5(7-10-3)4-6(8)9-2/h4H2,1-3H3.
What are the key properties of methyl 3-methoxyiminobutanoate?
methyl 3-methoxyiminobutanoate has a molecular weight of 145.16 g/mol, XLogP of 0.57, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methoxyiminobutanoate is sourced from PubChem (CID 72729968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).