C19H26N4O6 — CID 139816164
methyl 2-[[2-[[3,4-bis(methoxyimino)pentan-2-ylideneamino]oxymethyl]phenyl]methoxyimino]propanoate (PubChem CID 139816164) has the molecular formula C19H26N4O6 and a molecular weight of 406.44 g/mol. Its IUPAC name is methyl 2-[[2-[[3,4-bis(methoxyimino)pentan-2-ylideneamino]oxymethyl]phenyl]methoxyimino]propanoate.
| Compound Name | methyl 2-[[2-[[3,4-bis(methoxyimino)pentan-2-ylideneamino]oxymethyl]phenyl]methoxyimino]propanoate |
|---|---|
| PubChem CID | 139816164 |
| Molecular Formula | C19H26N4O6 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | methyl 2-[[2-[[3,4-bis(methoxyimino)pentan-2-ylideneamino]oxymethyl]phenyl]methoxyimino]propanoate |
| SMILES | CON=C(C)C(=NOC)C(C)=NOCc1ccccc1CON=C(C)C(=O)OC |
| InChI | InChI=1S/C19H26N4O6/c1-13(20-26-5)18(23-27-6)14(2)21-28-11-16-9-7-8-10-17(16)12-29-22-15(3)19(24)25-4/h7-10H,11-12H2,1-6H3 |
| InChIKey | HYSXLLBHYGGKPB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 112.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|