C8H14F2N2S — CID 163880553
(Z)-1-(1,1-difluoropropan-2-ylideneamino)-1-methylsulfanylbut-1-en-2-amine (PubChem CID 163880553) has the molecular formula C8H14F2N2S and a molecular weight of 208.28 g/mol. Its IUPAC name is (Z)-1-(1,1-difluoropropan-2-ylideneamino)-1-methylsulfanylbut-1-en-2-amine.
| Compound Name | (Z)-1-(1,1-difluoropropan-2-ylideneamino)-1-methylsulfanylbut-1-en-2-amine |
|---|---|
| PubChem CID | 163880553 |
| Molecular Formula | C8H14F2N2S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | (Z)-1-(1,1-difluoropropan-2-ylideneamino)-1-methylsulfanylbut-1-en-2-amine |
| SMILES | CC/C(N)=C(\N=C(C)C(F)F)SC |
| InChI | InChI=1S/C8H14F2N2S/c1-4-6(11)8(13-3)12-5(2)7(9)10/h7H,4,11H2,1-3H3/b8-6-,12-5? |
| InChIKey | PSVFZNNJCBRIOF-OYMLTPMBSA-N |
| XLogP | 2.61 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|