C14H23NO2S — CID 156706808
(Z,3E)-2,2-dimethyl-3-[(Z)-2-methyl-1-methylsulfanylbut-1-enyl]iminohex-4-enoic acid (PubChem CID 156706808) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is (Z,3E)-2,2-dimethyl-3-[(Z)-2-methyl-1-methylsulfanylbut-1-enyl]iminohex-4-enoic acid.
| Compound Name | (Z,3E)-2,2-dimethyl-3-[(Z)-2-methyl-1-methylsulfanylbut-1-enyl]iminohex-4-enoic acid |
|---|---|
| PubChem CID | 156706808 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (Z,3E)-2,2-dimethyl-3-[(Z)-2-methyl-1-methylsulfanylbut-1-enyl]iminohex-4-enoic acid |
| SMILES | C/C=C\C(=N/C(SC)=C(\C)CC)C(C)(C)C(=O)O |
| InChI | InChI=1S/C14H23NO2S/c1-7-9-11(14(4,5)13(16)17)15-12(18-6)10(3)8-2/h7,9H,8H2,1-6H3,(H,16,17)/b9-7-,12-10-,15-11+ |
| InChIKey | ARYHBQRKWJAGJK-WPCWICBQSA-N |
| XLogP | 4.12 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|