C7H9F3 — CID 175386742
3,4,5-trifluoro-2-methylhexa-1,4-diene (PubChem CID 175386742) has the molecular formula C7H9F3 and a molecular weight of 150.14 g/mol. Its IUPAC name is 3,4,5-trifluoro-2-methylhexa-1,4-diene.
| Compound Name | 3,4,5-trifluoro-2-methylhexa-1,4-diene |
|---|---|
| PubChem CID | 175386742 |
| Molecular Formula | C7H9F3 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 3,4,5-trifluoro-2-methylhexa-1,4-diene |
| SMILES | C=C(C)C(F)C(F)=C(C)F |
| InChI | InChI=1S/C7H9F3/c1-4(2)6(9)7(10)5(3)8/h6H,1H2,2-3H3 |
| InChIKey | LEPSXJODHYPCCG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|