C13H24O2 — CID 143447893
ethane;(3E,5Z)-3-ethoxy-2-methoxy-5-methylhepta-1,3,5-triene (PubChem CID 143447893) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is ethane;(3E,5Z)-3-ethoxy-2-methoxy-5-methylhepta-1,3,5-triene.
| Compound Name | ethane;(3E,5Z)-3-ethoxy-2-methoxy-5-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 143447893 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | ethane;(3E,5Z)-3-ethoxy-2-methoxy-5-methylhepta-1,3,5-triene |
| SMILES | C=C(OC)/C(=C\C(C)=C/C)OCC.CC |
| InChI | InChI=1S/C11H18O2.C2H6/c1-6-9(3)8-11(13-7-2)10(4)12-5;1-2/h6,8H,4,7H2,1-3,5H3;1-2H3/b9-6-,11-8+; |
| InChIKey | HTZGZTUNUCYPIV-GTLXCDPTSA-N |
| XLogP | 4.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|