C16H29NO — CID 177040279
(4E,6Z)-N-[(Z)-but-2-en-2-yl]-4-methoxy-6-methylocta-4,6-dien-3-imine;ethane (PubChem CID 177040279) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is (4E,6Z)-N-[(Z)-but-2-en-2-yl]-4-methoxy-6-methylocta-4,6-dien-3-imine;ethane.
| Compound Name | (4E,6Z)-N-[(Z)-but-2-en-2-yl]-4-methoxy-6-methylocta-4,6-dien-3-imine;ethane |
|---|---|
| PubChem CID | 177040279 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | (4E,6Z)-N-[(Z)-but-2-en-2-yl]-4-methoxy-6-methylocta-4,6-dien-3-imine;ethane |
| SMILES | C/C=C(C)\C=C(OC)/C(CC)=N/C(C)=C\C.CC |
| InChI | InChI=1S/C14H23NO.C2H6/c1-7-11(4)10-14(16-6)13(9-3)15-12(5)8-2;1-2/h7-8,10H,9H2,1-6H3;1-2H3/b11-7-,12-8-,14-10+,15-13+; |
| InChIKey | HSHFSPCKTIVADJ-WTQJKRMASA-N |
| XLogP | 5.28 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|