About (E)-3-bromo-N'-methylbut-2-enimidamide
(E)-3-bromo-N'-methylbut-2-enimidamide (PubChem CID 123167599) has the molecular formula C5H9BrN2
and a molecular weight of 177.05 g/mol. Its IUPAC name is (E)-3-bromo-N'-methylbut-2-enimidamide.
Molecular Properties
| Compound Name | (E)-3-bromo-N'-methylbut-2-enimidamide |
| PubChem CID | 123167599 |
| Molecular Formula | C5H9BrN2 |
| Molecular Weight | 177.05 g/mol |
| Exact Mass | 175.99 |
| IUPAC Name | (E)-3-bromo-N'-methylbut-2-enimidamide |
| SMILES | C/N=C(N)/C=C(\C)Br |
| InChI | InChI=1S/C5H9BrN2/c1-4(6)3-5(7)8-2/h3H,1-2H3,(H2,7,8)/b4-3+ |
| InChIKey | URDXQZUANOBIDZ-ONEGZZNKSA-N |
| XLogP | 1.27 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.05 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-bromo-N'-methylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-bromo-N'-methylbut-2-enimidamide?
The IUPAC name of (E)-3-bromo-N'-methylbut-2-enimidamide (CID 123167599) is (E)-3-bromo-N'-methylbut-2-enimidamide.
What is the SMILES notation for (E)-3-bromo-N'-methylbut-2-enimidamide?
The canonical SMILES for (E)-3-bromo-N'-methylbut-2-enimidamide is C/N=C(N)/C=C(\C)Br.
What is the InChIKey of (E)-3-bromo-N'-methylbut-2-enimidamide?
The InChIKey is URDXQZUANOBIDZ-ONEGZZNKSA-N. The full InChI is InChI=1S/C5H9BrN2/c1-4(6)3-5(7)8-2/h3H,1-2H3,(H2,7,8)/b4-3+.
What are the key properties of (E)-3-bromo-N'-methylbut-2-enimidamide?
(E)-3-bromo-N'-methylbut-2-enimidamide has a molecular weight of 177.05 g/mol, XLogP of 1.27, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-bromo-N'-methylbut-2-enimidamide is sourced from PubChem (CID 123167599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).